C9H14F6O2 — CID 53430948
8,8,8-trifluoro-7-(trifluoromethyl)octane-1,7-diol (PubChem CID 53430948) has the molecular formula C9H14F6O2 and a molecular weight of 268.20 g/mol. Its IUPAC name is 8,8,8-trifluoro-7-(trifluoromethyl)octane-1,7-diol.
| Compound Name | 8,8,8-trifluoro-7-(trifluoromethyl)octane-1,7-diol |
|---|---|
| PubChem CID | 53430948 |
| Molecular Formula | C9H14F6O2 |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 8,8,8-trifluoro-7-(trifluoromethyl)octane-1,7-diol |
| SMILES | OCCCCCCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F6O2/c10-8(11,12)7(17,9(13,14)15)5-3-1-2-4-6-16/h16-17H,1-6H2 |
| InChIKey | KXXYOKWKLSYEEX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|