C7H9F6N3O — CID 150637260
6-azido-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol (PubChem CID 150637260) has the molecular formula C7H9F6N3O and a molecular weight of 265.16 g/mol. Its IUPAC name is 6-azido-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol.
| Compound Name | 6-azido-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol |
|---|---|
| PubChem CID | 150637260 |
| Molecular Formula | C7H9F6N3O |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 6-azido-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol |
| SMILES | [N-]=[N+]=NCCCCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H9F6N3O/c8-6(9,10)5(17,7(11,12)13)3-1-2-4-15-16-14/h17H,1-4H2 |
| InChIKey | IZDOERHJVYAZBQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|