C6H7F6N3O2 — CID 171362973
2-(2-azidoethoxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 171362973) has the molecular formula C6H7F6N3O2 and a molecular weight of 267.13 g/mol. Its IUPAC name is 2-(2-azidoethoxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2-azidoethoxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 171362973 |
| Molecular Formula | C6H7F6N3O2 |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-(2-azidoethoxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | [N-]=[N+]=NCCOCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F6N3O2/c7-5(8,9)4(16,6(10,11)12)3-17-2-1-14-15-13/h16H,1-3H2 |
| InChIKey | SZKKYJMMAQEASB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|