C13H22F6O2 — CID 21261674
10,10,10-trifluoro-5,5-dimethyl-9-(trifluoromethyl)decane-1,9-diol (PubChem CID 21261674) has the molecular formula C13H22F6O2 and a molecular weight of 324.31 g/mol. Its IUPAC name is 10,10,10-trifluoro-5,5-dimethyl-9-(trifluoromethyl)decane-1,9-diol.
| Compound Name | 10,10,10-trifluoro-5,5-dimethyl-9-(trifluoromethyl)decane-1,9-diol |
|---|---|
| PubChem CID | 21261674 |
| Molecular Formula | C13H22F6O2 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 10,10,10-trifluoro-5,5-dimethyl-9-(trifluoromethyl)decane-1,9-diol |
| SMILES | CC(C)(CCCCO)CCCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H22F6O2/c1-10(2,6-3-4-9-20)7-5-8-11(21,12(14,15)16)13(17,18)19/h20-21H,3-9H2,1-2H3 |
| InChIKey | XHCJEADJXBLDLH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|