C17H30F6OY — CID 58205850
1,1,1-trifluoro-6,6,8,8,9,9-hexamethyl-2-(trifluoromethyl)decan-2-ol;yttrium (PubChem CID 58205850) has the molecular formula C17H30F6OY and a molecular weight of 453.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-6,6,8,8,9,9-hexamethyl-2-(trifluoromethyl)decan-2-ol;yttrium.
| Compound Name | 1,1,1-trifluoro-6,6,8,8,9,9-hexamethyl-2-(trifluoromethyl)decan-2-ol;yttrium |
|---|---|
| PubChem CID | 58205850 |
| Molecular Formula | C17H30F6OY |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1,1,1-trifluoro-6,6,8,8,9,9-hexamethyl-2-(trifluoromethyl)decan-2-ol;yttrium |
| SMILES | CC(C)(CCCC(O)(C(F)(F)F)C(F)(F)F)CC(C)(C)C(C)(C)C.[Y] |
| InChI | InChI=1S/C17H30F6O.Y/c1-12(2,3)14(6,7)11-13(4,5)9-8-10-15(24,16(18,19)20)17(21,22)23;/h24H,8-11H2,1-7H3; |
| InChIKey | OOTXSANAUJHFIT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |