C21H32F6O3 — CID 173271316
trans-(1R,3R)-5-[12,12,12-trifluoro-11-hydroxy-7,7-dimethyl-11-(trifluoromethyl)dodec-2-enylidene]cyclohexane-1,3-diol (PubChem CID 173271316) has the molecular formula C21H32F6O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is trans-(1R,3R)-5-[12,12,12-trifluoro-11-hydroxy-7,7-dimethyl-11-(trifluoromethyl)dodec-2-enylidene]cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[12,12,12-trifluoro-11-hydroxy-7,7-dimethyl-11-(trifluoromethyl)dodec-2-enylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 173271316 |
| Molecular Formula | C21H32F6O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | trans-(1R,3R)-5-[12,12,12-trifluoro-11-hydroxy-7,7-dimethyl-11-(trifluoromethyl)dodec-2-enylidene]cyclohexane-1,3-diol |
| SMILES | CC(C)(CCCC=CC=C1C[C@@H](O)C[C@H](O)C1)CCCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H32F6O3/c1-18(2,10-7-11-19(30,20(22,23)24)21(25,26)27)9-6-4-3-5-8-15-12-16(28)14-17(29)13-15/h3,5,8,16-17,28-30H,4,6-7,9-14H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | XTTAZBGJFAPIOL-IAGOWNOFSA-N |
| XLogP | 5.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|