C19H38F6O — CID 160736312
methane;1,1,1-trifluoro-6,6,8,8,9,9-hexamethyl-2-(trifluoromethyl)decan-2-ol (PubChem CID 160736312) has the molecular formula C19H38F6O and a molecular weight of 396.50 g/mol. Its IUPAC name is methane;1,1,1-trifluoro-6,6,8,8,9,9-hexamethyl-2-(trifluoromethyl)decan-2-ol.
| Compound Name | methane;1,1,1-trifluoro-6,6,8,8,9,9-hexamethyl-2-(trifluoromethyl)decan-2-ol |
|---|---|
| PubChem CID | 160736312 |
| Molecular Formula | C19H38F6O |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | methane;1,1,1-trifluoro-6,6,8,8,9,9-hexamethyl-2-(trifluoromethyl)decan-2-ol |
| SMILES | C.C.CC(C)(CCCC(O)(C(F)(F)F)C(F)(F)F)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30F6O.2CH4/c1-12(2,3)14(6,7)11-13(4,5)9-8-10-15(24,16(18,19)20)17(21,22)23;;/h24H,8-11H2,1-7H3;2*1H4 |
| InChIKey | RUZNRIDEQWLBOJ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |