C7H10F6O — CID 116535920
1,1,1,6,6,6-hexafluoro-2-methylhexan-2-ol (PubChem CID 116535920) has the molecular formula C7H10F6O and a molecular weight of 224.14 g/mol. Its IUPAC name is 1,1,1,6,6,6-hexafluoro-2-methylhexan-2-ol.
| Compound Name | 1,1,1,6,6,6-hexafluoro-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 116535920 |
| Molecular Formula | C7H10F6O |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1,1,1,6,6,6-hexafluoro-2-methylhexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10F6O/c1-5(14,7(11,12)13)3-2-4-6(8,9)10/h14H,2-4H2,1H3 |
| InChIKey | FLWOAZGVOPZPIZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |