C10H16F3NO — CID 116536353
7,7,7-trifluoro-3-hydroxy-2,2,3-trimethylheptanenitrile (PubChem CID 116536353) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is 7,7,7-trifluoro-3-hydroxy-2,2,3-trimethylheptanenitrile.
| Compound Name | 7,7,7-trifluoro-3-hydroxy-2,2,3-trimethylheptanenitrile |
|---|---|
| PubChem CID | 116536353 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 7,7,7-trifluoro-3-hydroxy-2,2,3-trimethylheptanenitrile |
| SMILES | CC(C)(C#N)C(C)(O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H16F3NO/c1-8(2,7-14)9(3,15)5-4-6-10(11,12)13/h15H,4-6H2,1-3H3 |
| InChIKey | UHSDJRSBGXSCNZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |