C10H13F3N2 — CID 116535500
6,6,6-trifluoro-2-methyl-2-(prop-2-ynylamino)hexanenitrile (PubChem CID 116535500) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-methyl-2-(prop-2-ynylamino)hexanenitrile.
| Compound Name | 6,6,6-trifluoro-2-methyl-2-(prop-2-ynylamino)hexanenitrile |
|---|---|
| PubChem CID | 116535500 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 6,6,6-trifluoro-2-methyl-2-(prop-2-ynylamino)hexanenitrile |
| SMILES | C#CCNC(C)(C#N)CCCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N2/c1-3-7-15-9(2,8-14)5-4-6-10(11,12)13/h1,15H,4-7H2,2H3 |
| InChIKey | XCZYKDRSBRCLNO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|