C10H16F3NO2 — CID 103376454
6,6,6-trifluoro-2-(3-hydroxypropoxy)-2-methylhexanenitrile (PubChem CID 103376454) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-(3-hydroxypropoxy)-2-methylhexanenitrile.
| Compound Name | 6,6,6-trifluoro-2-(3-hydroxypropoxy)-2-methylhexanenitrile |
|---|---|
| PubChem CID | 103376454 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 6,6,6-trifluoro-2-(3-hydroxypropoxy)-2-methylhexanenitrile |
| SMILES | CC(C#N)(CCCC(F)(F)F)OCCCO |
| InChI | InChI=1S/C10H16F3NO2/c1-9(8-14,16-7-3-6-15)4-2-5-10(11,12)13/h15H,2-7H2,1H3 |
| InChIKey | CTTHBJVLUUEAPR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|