C8H11F5O3 — CID 116536109
2,2,7,7,7-pentafluoro-3-hydroxy-3-methylheptanoic acid (PubChem CID 116536109) has the molecular formula C8H11F5O3 and a molecular weight of 250.16 g/mol. Its IUPAC name is 2,2,7,7,7-pentafluoro-3-hydroxy-3-methylheptanoic acid.
| Compound Name | 2,2,7,7,7-pentafluoro-3-hydroxy-3-methylheptanoic acid |
|---|---|
| PubChem CID | 116536109 |
| Molecular Formula | C8H11F5O3 |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2,2,7,7,7-pentafluoro-3-hydroxy-3-methylheptanoic acid |
| SMILES | CC(O)(CCCC(F)(F)F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C8H11F5O3/c1-6(16,8(12,13)5(14)15)3-2-4-7(9,10)11/h16H,2-4H2,1H3,(H,14,15) |
| InChIKey | WVEKGTOUYHONFM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |