C21H36O3 — CID 15981401
trans-(1R,3R)-5-[(E,7R)-11-hydroxy-7,11-dimethyldodec-2-enylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 15981401) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(E,7R)-11-hydroxy-7,11-dimethyldodec-2-enylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(E,7R)-11-hydroxy-7,11-dimethyldodec-2-enylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 15981401 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | trans-(1R,3R)-5-[(E,7R)-11-hydroxy-7,11-dimethyldodec-2-enylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)CC(=C/C=C/CCC[C@@H](C)CCCC(C)(C)O)C[C@H]1O |
| InChI | InChI=1S/C21H36O3/c1-16(11-9-13-21(3,4)24)10-7-5-6-8-12-18-14-19(22)17(2)20(23)15-18/h6,8,12,16,19-20,22-24H,2,5,7,9-11,13-15H2,1,3-4H3/b8-6+/t16-,19-,20-/m1/s1 |
| InChIKey | LUSMPDMKQNFYAA-VTGVEZJUSA-N |
| XLogP | 4.29 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|