C10H9F9O3 — CID 23593436
[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentyl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 23593436) has the molecular formula C10H9F9O3 and a molecular weight of 348.16 g/mol. Its IUPAC name is [5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentyl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentyl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 23593436 |
| Molecular Formula | C10H9F9O3 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | [5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentyl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OCCCC(O)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F9O3/c1-5(8(11,12)13)6(20)22-4-2-3-7(21,9(14,15)16)10(17,18)19/h21H,1-4H2 |
| InChIKey | DKBSLSRQSJVVCC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|