C12H15F3O6 — CID 159777965
2-methylprop-2-enoic acid;4-[2-(trifluoromethyl)prop-2-enoyloxy]butanoic acid (PubChem CID 159777965) has the molecular formula C12H15F3O6 and a molecular weight of 312.24 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;4-[2-(trifluoromethyl)prop-2-enoyloxy]butanoic acid.
| Compound Name | 2-methylprop-2-enoic acid;4-[2-(trifluoromethyl)prop-2-enoyloxy]butanoic acid |
|---|---|
| PubChem CID | 159777965 |
| Molecular Formula | C12H15F3O6 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-methylprop-2-enoic acid;4-[2-(trifluoromethyl)prop-2-enoyloxy]butanoic acid |
| SMILES | C=C(C(=O)OCCCC(=O)O)C(F)(F)F.C=C(C)C(=O)O |
| InChI | InChI=1S/C8H9F3O4.C4H6O2/c1-5(8(9,10)11)7(14)15-4-2-3-6(12)13;1-3(2)4(5)6/h1-4H2,(H,12,13);1H2,2H3,(H,5,6) |
| InChIKey | NGZJKTPRLZCBLO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|