C13H22O10S2 — CID 154927960
2-methylprop-2-enoic acid;4-(3-sulfopropoxycarbonyl)pent-4-ene-1-sulfonic acid (PubChem CID 154927960) has the molecular formula C13H22O10S2 and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;4-(3-sulfopropoxycarbonyl)pent-4-ene-1-sulfonic acid.
| Compound Name | 2-methylprop-2-enoic acid;4-(3-sulfopropoxycarbonyl)pent-4-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 154927960 |
| Molecular Formula | C13H22O10S2 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-methylprop-2-enoic acid;4-(3-sulfopropoxycarbonyl)pent-4-ene-1-sulfonic acid |
| SMILES | C=C(C)C(=O)O.C=C(CCCS(=O)(=O)O)C(=O)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C9H16O8S2.C4H6O2/c1-8(4-2-6-18(11,12)13)9(10)17-5-3-7-19(14,15)16;1-3(2)4(5)6/h1-7H2,(H,11,12,13)(H,14,15,16);1H2,2H3,(H,5,6) |
| InChIKey | XCMGQDUBWVOGNK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 172.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|