2-methylidene-5-sulfopentanoic acid

C12H20O10S2 — CID 158153220

IUPAC2-methylidene-5-sulfopentanoic acid
SMILESC=C(CCCS(=O)(=O)O)C(=O)O.C=C(CCCS(=O)(=O)O)C(=O)O
InChIInChI=1S/2C6H10O5S/c2*1-5(6(7)8)3-2-4-12(9,10)11/h2*1-4H2,(H,7,8)(H,9,10,11)
InChIKeyFVJHQHRXJHDVHM-UHFFFAOYSA-N
MW388.42 g/mol
LogP0.59
Rot. Bonds10

About 2-methylidene-5-sulfopentanoic acid

2-methylidene-5-sulfopentanoic acid (PubChem CID 158153220) has the molecular formula C12H20O10S2 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-methylidene-5-sulfopentanoic acid.

Molecular Properties

Compound Name2-methylidene-5-sulfopentanoic acid
PubChem CID158153220
Molecular FormulaC12H20O10S2
Molecular Weight388.42 g/mol
Exact Mass388.05
IUPAC Name2-methylidene-5-sulfopentanoic acid
SMILESC=C(CCCS(=O)(=O)O)C(=O)O.C=C(CCCS(=O)(=O)O)C(=O)O
InChIInChI=1S/2C6H10O5S/c2*1-5(6(7)8)3-2-4-12(9,10)11/h2*1-4H2,(H,7,8)(H,9,10,11)
InChIKeyFVJHQHRXJHDVHM-UHFFFAOYSA-N
XLogP0.59
TPSA183.34 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500388.42
LogP ≤ 50.59
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-methylidene-5-sulfopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylidene-5-sulfopentanoic acid?
The IUPAC name of 2-methylidene-5-sulfopentanoic acid (CID 158153220) is 2-methylidene-5-sulfopentanoic acid.
What is the SMILES notation for 2-methylidene-5-sulfopentanoic acid?
The canonical SMILES for 2-methylidene-5-sulfopentanoic acid is C=C(CCCS(=O)(=O)O)C(=O)O.C=C(CCCS(=O)(=O)O)C(=O)O.
What is the InChIKey of 2-methylidene-5-sulfopentanoic acid?
The InChIKey is FVJHQHRXJHDVHM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H10O5S/c2*1-5(6(7)8)3-2-4-12(9,10)11/h2*1-4H2,(H,7,8)(H,9,10,11).
What are the key properties of 2-methylidene-5-sulfopentanoic acid?
2-methylidene-5-sulfopentanoic acid has a molecular weight of 388.42 g/mol, XLogP of 0.59, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-5-sulfopentanoic acid is sourced from PubChem (CID 158153220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).