C13H23NO9S2 — CID 87837831
2-methylidene-5-sulfopentanoic acid;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid (PubChem CID 87837831) has the molecular formula C13H23NO9S2 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-methylidene-5-sulfopentanoic acid;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid.
| Compound Name | 2-methylidene-5-sulfopentanoic acid;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87837831 |
| Molecular Formula | C13H23NO9S2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-methylidene-5-sulfopentanoic acid;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
| SMILES | C=C(CCCS(=O)(=O)O)C(=O)O.C=CC(=O)NC(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C7H13NO4S.C6H10O5S/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-5(6(7)8)3-2-4-12(9,10)11/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);1-4H2,(H,7,8)(H,9,10,11) |
| InChIKey | CSOQKFDBIHFBFW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 175.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|