C7H16AlNO4S — CID 173293073
alumane;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid (PubChem CID 173293073) has the molecular formula C7H16AlNO4S and a molecular weight of 237.26 g/mol. Its IUPAC name is alumane;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid.
| Compound Name | alumane;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 173293073 |
| Molecular Formula | C7H16AlNO4S |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | alumane;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)O.[AlH3] |
| InChI | InChI=1S/C7H13NO4S.Al.3H/c1-4-6(9)8-7(2,3)5-13(10,11)12;;;;/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);;;; |
| InChIKey | UILNURRIHYIFHN-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|