C8H16NNaO5S — CID 175540751
sodium;methanol;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate (PubChem CID 175540751) has the molecular formula C8H16NNaO5S and a molecular weight of 261.27 g/mol. Its IUPAC name is sodium;methanol;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate.
| Compound Name | sodium;methanol;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 175540751 |
| Molecular Formula | C8H16NNaO5S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | sodium;methanol;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)[O-].CO.[Na+] |
| InChI | InChI=1S/C7H13NO4S.CH4O.Na/c1-4-6(9)8-7(2,3)5-13(10,11)12;1-2;/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);2H,1H3;/q;;+1/p-1 |
| InChIKey | GJNONIWHZGATRY-UHFFFAOYSA-M |
| XLogP | -3.78 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|