C13H22O5 — CID 160952055
3-ethoxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 160952055) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 3-ethoxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | 3-ethoxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 160952055 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-ethoxypropyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCCCOCC |
| InChI | InChI=1S/C9H16O3.C4H6O2/c1-4-11-6-5-7-12-9(10)8(2)3;1-3(2)4(5)6/h2,4-7H2,1,3H3;1H2,2H3,(H,5,6) |
| InChIKey | SVWSDGFXYDDQIS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|