C10H12F5NO7S — CID 118600903
1,1-difluoro-3-[2-[2-(trifluoromethyl)prop-2-enoyloxy]ethylcarbamoyloxy]propane-1-sulfonic acid (PubChem CID 118600903) has the molecular formula C10H12F5NO7S and a molecular weight of 385.26 g/mol. Its IUPAC name is 1,1-difluoro-3-[2-[2-(trifluoromethyl)prop-2-enoyloxy]ethylcarbamoyloxy]propane-1-sulfonic acid.
| Compound Name | 1,1-difluoro-3-[2-[2-(trifluoromethyl)prop-2-enoyloxy]ethylcarbamoyloxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 118600903 |
| Molecular Formula | C10H12F5NO7S |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 1,1-difluoro-3-[2-[2-(trifluoromethyl)prop-2-enoyloxy]ethylcarbamoyloxy]propane-1-sulfonic acid |
| SMILES | C=C(C(=O)OCCNC(=O)OCCC(F)(F)S(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H12F5NO7S/c1-6(10(13,14)15)7(17)22-5-3-16-8(18)23-4-2-9(11,12)24(19,20)21/h1-5H2,(H,16,18)(H,19,20,21) |
| InChIKey | FVFNSKYMPQERPT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|