C9H5F9O4 — CID 134465608
[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 134465608) has the molecular formula C9H5F9O4 and a molecular weight of 348.12 g/mol. Its IUPAC name is [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134465608 |
| Molecular Formula | C9H5F9O4 |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OCC(=O)OC(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5F9O4/c1-3(7(10,11)12)5(20)21-2-4(19)22-6(8(13,14)15)9(16,17)18/h6H,1-2H2 |
| InChIKey | TYMXYVFVLWTNIW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|