C9H6F8O4S — CID 89082932
[3-(2,2-difluoro-2-sulfanylethoxy)-1,1,1-trifluoro-3-oxopropan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 89082932) has the molecular formula C9H6F8O4S and a molecular weight of 362.19 g/mol. Its IUPAC name is [3-(2,2-difluoro-2-sulfanylethoxy)-1,1,1-trifluoro-3-oxopropan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [3-(2,2-difluoro-2-sulfanylethoxy)-1,1,1-trifluoro-3-oxopropan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 89082932 |
| Molecular Formula | C9H6F8O4S |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | [3-(2,2-difluoro-2-sulfanylethoxy)-1,1,1-trifluoro-3-oxopropan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C(=O)OCC(F)(F)S)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6F8O4S/c1-3(8(12,13)14)5(18)21-4(9(15,16)17)6(19)20-2-7(10,11)22/h4,22H,1-2H2 |
| InChIKey | JADLBSLRSBSXHP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|