C8H14F3O5P — CID 11864422
ethyl (2R)-2-[ethoxy(methyl)phosphoryl]oxy-3,3,3-trifluoropropanoate (PubChem CID 11864422) has the molecular formula C8H14F3O5P and a molecular weight of 278.16 g/mol. Its IUPAC name is ethyl (2R)-2-[ethoxy(methyl)phosphoryl]oxy-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2R)-2-[ethoxy(methyl)phosphoryl]oxy-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 11864422 |
| Molecular Formula | C8H14F3O5P |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | ethyl (2R)-2-[ethoxy(methyl)phosphoryl]oxy-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)[C@@H](O[P@](C)(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C8H14F3O5P/c1-4-14-7(12)6(8(9,10)11)16-17(3,13)15-5-2/h6H,4-5H2,1-3H3/t6-,17-/m1/s1 |
| InChIKey | AXHTUWKPKDMBOU-ZWBDZOEQSA-N |
| XLogP | 2.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|