C9H17F2O4P — CID 158014067
[2-[ethoxy(methyl)phosphoryl]-2,2-difluoroethyl] prop-2-enoate;methane (PubChem CID 158014067) has the molecular formula C9H17F2O4P and a molecular weight of 258.20 g/mol. Its IUPAC name is [2-[ethoxy(methyl)phosphoryl]-2,2-difluoroethyl] prop-2-enoate;methane.
| Compound Name | [2-[ethoxy(methyl)phosphoryl]-2,2-difluoroethyl] prop-2-enoate;methane |
|---|---|
| PubChem CID | 158014067 |
| Molecular Formula | C9H17F2O4P |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | [2-[ethoxy(methyl)phosphoryl]-2,2-difluoroethyl] prop-2-enoate;methane |
| SMILES | C.C=CC(=O)OCC(F)(F)P(C)(=O)OCC |
| InChI | InChI=1S/C8H13F2O4P.CH4/c1-4-7(11)13-6-8(9,10)15(3,12)14-5-2;/h4H,1,5-6H2,2-3H3;1H4 |
| InChIKey | FFGADLYEBUYFSQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|