C10H15F6O5P — CID 10926473
ethyl 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]butanoate (PubChem CID 10926473) has the molecular formula C10H15F6O5P and a molecular weight of 360.19 g/mol. Its IUPAC name is ethyl 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]butanoate.
| Compound Name | ethyl 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]butanoate |
|---|---|
| PubChem CID | 10926473 |
| Molecular Formula | C10H15F6O5P |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | ethyl 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]butanoate |
| SMILES | CCOC(=O)C(CC)P(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C10H15F6O5P/c1-3-7(8(17)19-4-2)22(18,20-5-9(11,12)13)21-6-10(14,15)16/h7H,3-6H2,1-2H3 |
| InChIKey | LCMGMWSLXHIDMC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|