C11H17F3O4 — CID 103150167
ethyl 2-ethyl-3-oxo-5-(2,2,2-trifluoroethoxy)pentanoate (PubChem CID 103150167) has the molecular formula C11H17F3O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is ethyl 2-ethyl-3-oxo-5-(2,2,2-trifluoroethoxy)pentanoate.
| Compound Name | ethyl 2-ethyl-3-oxo-5-(2,2,2-trifluoroethoxy)pentanoate |
|---|---|
| PubChem CID | 103150167 |
| Molecular Formula | C11H17F3O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | ethyl 2-ethyl-3-oxo-5-(2,2,2-trifluoroethoxy)pentanoate |
| SMILES | CCOC(=O)C(CC)C(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C11H17F3O4/c1-3-8(10(16)18-4-2)9(15)5-6-17-7-11(12,13)14/h8H,3-7H2,1-2H3 |
| InChIKey | UJBNOBFWTOGCHP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|