C11H17F3O4 — CID 57230566
1-O-ethyl 3-O-(1,1,1-trifluoro-2-methylpropan-2-yl) 2-ethylpropanedioate (PubChem CID 57230566) has the molecular formula C11H17F3O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is 1-O-ethyl 3-O-(1,1,1-trifluoro-2-methylpropan-2-yl) 2-ethylpropanedioate.
| Compound Name | 1-O-ethyl 3-O-(1,1,1-trifluoro-2-methylpropan-2-yl) 2-ethylpropanedioate |
|---|---|
| PubChem CID | 57230566 |
| Molecular Formula | C11H17F3O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-O-ethyl 3-O-(1,1,1-trifluoro-2-methylpropan-2-yl) 2-ethylpropanedioate |
| SMILES | CCOC(=O)C(CC)C(=O)OC(C)(C)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O4/c1-5-7(8(15)17-6-2)9(16)18-10(3,4)11(12,13)14/h7H,5-6H2,1-4H3 |
| InChIKey | ZVTKEGNGARQCNW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|