C12H24F6NO4P — CID 171928293
bis(2,2,2-trifluoroethyl) hydrogen phosphate;N-butan-2-ylbutan-2-amine (PubChem CID 171928293) has the molecular formula C12H24F6NO4P and a molecular weight of 391.29 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) hydrogen phosphate;N-butan-2-ylbutan-2-amine.
| Compound Name | bis(2,2,2-trifluoroethyl) hydrogen phosphate;N-butan-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 171928293 |
| Molecular Formula | C12H24F6NO4P |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) hydrogen phosphate;N-butan-2-ylbutan-2-amine |
| SMILES | CCC(C)NC(C)CC.O=P(O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C8H19N.C4H5F6O4P/c1-5-7(3)9-8(4)6-2;5-3(6,7)1-13-15(11,12)14-2-4(8,9)10/h7-9H,5-6H2,1-4H3;1-2H2,(H,11,12) |
| InChIKey | ZOFIFRUYWZREMC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|