About 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate
2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate (PubChem CID 174547612) has the molecular formula C5H12F3O4PSi
and a molecular weight of 252.20 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate |
| PubChem CID | 174547612 |
| Molecular Formula | C5H12F3O4PSi |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate |
| SMILES | C[Si](C)(C)OP(=O)(O)OCC(F)(F)F |
| InChI | InChI=1S/C5H12F3O4PSi/c1-14(2,3)12-13(9,10)11-4-5(6,7)8/h4H2,1-3H3,(H,9,10) |
| InChIKey | SDXQNXKOSNYWLT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate?
The IUPAC name of 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate (CID 174547612) is 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate.
What is the SMILES notation for 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate?
The canonical SMILES for 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate is C[Si](C)(C)OP(=O)(O)OCC(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate?
The InChIKey is SDXQNXKOSNYWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12F3O4PSi/c1-14(2,3)12-13(9,10)11-4-5(6,7)8/h4H2,1-3H3,(H,9,10).
What are the key properties of 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate?
2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate has a molecular weight of 252.20 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl trimethylsilyl hydrogen phosphate is sourced from PubChem (CID 174547612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).