C3H3F6O3P — CID 118503856
2,2,2-trifluoroethoxy(trifluoromethyl)phosphinic acid (PubChem CID 118503856) has the molecular formula C3H3F6O3P and a molecular weight of 232.02 g/mol. Its IUPAC name is 2,2,2-trifluoroethoxy(trifluoromethyl)phosphinic acid.
| Compound Name | 2,2,2-trifluoroethoxy(trifluoromethyl)phosphinic acid |
|---|---|
| PubChem CID | 118503856 |
| Molecular Formula | C3H3F6O3P |
| Molecular Weight | 232.02 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 2,2,2-trifluoroethoxy(trifluoromethyl)phosphinic acid |
| SMILES | O=P(O)(OCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3H3F6O3P/c4-2(5,6)1-12-13(10,11)3(7,8)9/h1H2,(H,10,11) |
| InChIKey | FPZKLTVAPZLYDE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.02 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|