C6H7F6O5P — CID 87580353
[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]-(2,2,2-trifluoroethoxy)phosphinic acid (PubChem CID 87580353) has the molecular formula C6H7F6O5P and a molecular weight of 304.08 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]-(2,2,2-trifluoroethoxy)phosphinic acid.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]-(2,2,2-trifluoroethoxy)phosphinic acid |
|---|---|
| PubChem CID | 87580353 |
| Molecular Formula | C6H7F6O5P |
| Molecular Weight | 304.08 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]-(2,2,2-trifluoroethoxy)phosphinic acid |
| SMILES | O=C(CP(=O)(O)OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C6H7F6O5P/c7-5(8,9)2-16-4(13)1-18(14,15)17-3-6(10,11)12/h1-3H2,(H,14,15) |
| InChIKey | ZJDWFAVALQXOMS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.08 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|