C8H10F3O4- — CID 152751982
6-oxo-6-(2,2,2-trifluoroethoxy)hexanoate (PubChem CID 152751982) has the molecular formula C8H10F3O4- and a molecular weight of 227.16 g/mol. Its IUPAC name is 6-oxo-6-(2,2,2-trifluoroethoxy)hexanoate.
| Compound Name | 6-oxo-6-(2,2,2-trifluoroethoxy)hexanoate |
|---|---|
| PubChem CID | 152751982 |
| Molecular Formula | C8H10F3O4- |
| Molecular Weight | 227.16 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 6-oxo-6-(2,2,2-trifluoroethoxy)hexanoate |
| SMILES | O=C([O-])CCCCC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C8H11F3O4/c9-8(10,11)5-15-7(14)4-2-1-3-6(12)13/h1-5H2,(H,12,13)/p-1 |
| InChIKey | VJUZVOGRUCRQDJ-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.16 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|