About azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate
azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate (PubChem CID 20517212) has the molecular formula C18H34N2O8-2
and a molecular weight of 406.48 g/mol. Its IUPAC name is azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate.
Molecular Properties
| Compound Name | azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate |
| PubChem CID | 20517212 |
| Molecular Formula | C18H34N2O8-2 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate |
| SMILES | N.N.O=C([O-])CCCCC(=O)OCCCCCCOC(=O)CCCCC(=O)[O-] |
| InChI | InChI=1S/C18H30O8.2H3N/c19-15(20)9-3-5-11-17(23)25-13-7-1-2-8-14-26-18(24)12-6-4-10-16(21)22;;/h1-14H2,(H,19,20)(H,21,22);2*1H3/p-2 |
| InChIKey | AVDFPLLYPXFADJ-UHFFFAOYSA-L |
| XLogP | 0.58 |
| TPSA | 202.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate?
The IUPAC name of azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate (CID 20517212) is azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate.
What is the SMILES notation for azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate?
The canonical SMILES for azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate is N.N.O=C([O-])CCCCC(=O)OCCCCCCOC(=O)CCCCC(=O)[O-].
What is the InChIKey of azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate?
The InChIKey is AVDFPLLYPXFADJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H30O8.2H3N/c19-15(20)9-3-5-11-17(23)25-13-7-1-2-8-14-26-18(24)12-6-4-10-16(21)22;;/h1-14H2,(H,19,20)(H,21,22);2*1H3/p-2.
What are the key properties of azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate?
azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate has a molecular weight of 406.48 g/mol, XLogP of 0.58, 17 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for azane;6-[6-(5-carboxylatopentanoyloxy)hexoxy]-6-oxohexanoate is sourced from PubChem (CID 20517212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).