About 6-octoxy-6-oxohexanoate
6-octoxy-6-oxohexanoate (PubChem CID 22672253) has the molecular formula C14H25O4-
and a molecular weight of 257.35 g/mol. Its IUPAC name is 6-octoxy-6-oxohexanoate.
Molecular Properties
| Compound Name | 6-octoxy-6-oxohexanoate |
| PubChem CID | 22672253 |
| Molecular Formula | C14H25O4- |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 6-octoxy-6-oxohexanoate |
| SMILES | CCCCCCCCOC(=O)CCCCC(=O)[O-] |
| InChI | InChI=1S/C14H26O4/c1-2-3-4-5-6-9-12-18-14(17)11-8-7-10-13(15)16/h2-12H2,1H3,(H,15,16)/p-1 |
| InChIKey | IHLDEDLAZNFOJB-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-octoxy-6-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-octoxy-6-oxohexanoate?
The IUPAC name of 6-octoxy-6-oxohexanoate (CID 22672253) is 6-octoxy-6-oxohexanoate.
What is the SMILES notation for 6-octoxy-6-oxohexanoate?
The canonical SMILES for 6-octoxy-6-oxohexanoate is CCCCCCCCOC(=O)CCCCC(=O)[O-].
What is the InChIKey of 6-octoxy-6-oxohexanoate?
The InChIKey is IHLDEDLAZNFOJB-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H26O4/c1-2-3-4-5-6-9-12-18-14(17)11-8-7-10-13(15)16/h2-12H2,1H3,(H,15,16)/p-1.
What are the key properties of 6-octoxy-6-oxohexanoate?
6-octoxy-6-oxohexanoate has a molecular weight of 257.35 g/mol, XLogP of 2.20, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-octoxy-6-oxohexanoate is sourced from PubChem (CID 22672253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).