potassium 6-dodecoxy-6-oxohexanoate

C18H33KO4 — CID 102118511

IUPACpotassium 6-dodecoxy-6-oxohexanoate
SMILESCCCCCCCCCCCCOC(=O)CCCCC(=O)[O-].[K+]
InChIInChI=1S/C18H34O4.K/c1-2-3-4-5-6-7-8-9-10-13-16-22-18(21)15-12-11-14-17(19)20;/h2-16H2,1H3,(H,19,20);/q;+1/p-1
InChIKeyNHWFEZCRVLLDGG-UHFFFAOYSA-M
MW352.56 g/mol
LogP0.76
Rot. Bonds16

About potassium 6-dodecoxy-6-oxohexanoate

potassium 6-dodecoxy-6-oxohexanoate (PubChem CID 102118511) has the molecular formula C18H33KO4 and a molecular weight of 352.56 g/mol. Its IUPAC name is potassium 6-dodecoxy-6-oxohexanoate.

Molecular Properties

Compound Namepotassium 6-dodecoxy-6-oxohexanoate
PubChem CID102118511
Molecular FormulaC18H33KO4
Molecular Weight352.56 g/mol
Exact Mass352.20
IUPAC Namepotassium 6-dodecoxy-6-oxohexanoate
SMILESCCCCCCCCCCCCOC(=O)CCCCC(=O)[O-].[K+]
InChIInChI=1S/C18H34O4.K/c1-2-3-4-5-6-7-8-9-10-13-16-22-18(21)15-12-11-14-17(19)20;/h2-16H2,1H3,(H,19,20);/q;+1/p-1
InChIKeyNHWFEZCRVLLDGG-UHFFFAOYSA-M
XLogP0.76
TPSA66.43 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds16
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.56
LogP ≤ 50.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze potassium 6-dodecoxy-6-oxohexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 6-dodecoxy-6-oxohexanoate?
The IUPAC name of potassium 6-dodecoxy-6-oxohexanoate (CID 102118511) is potassium 6-dodecoxy-6-oxohexanoate.
What is the SMILES notation for potassium 6-dodecoxy-6-oxohexanoate?
The canonical SMILES for potassium 6-dodecoxy-6-oxohexanoate is CCCCCCCCCCCCOC(=O)CCCCC(=O)[O-].[K+].
What is the InChIKey of potassium 6-dodecoxy-6-oxohexanoate?
The InChIKey is NHWFEZCRVLLDGG-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H34O4.K/c1-2-3-4-5-6-7-8-9-10-13-16-22-18(21)15-12-11-14-17(19)20;/h2-16H2,1H3,(H,19,20);/q;+1/p-1.
What are the key properties of potassium 6-dodecoxy-6-oxohexanoate?
potassium 6-dodecoxy-6-oxohexanoate has a molecular weight of 352.56 g/mol, XLogP of 0.76, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 6-dodecoxy-6-oxohexanoate is sourced from PubChem (CID 102118511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).