C6H12F6NO4P — CID 118073252
bis(2,2,2-trifluoroethyl) hydrogen phosphate;N-methylmethanamine (PubChem CID 118073252) has the molecular formula C6H12F6NO4P and a molecular weight of 307.13 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) hydrogen phosphate;N-methylmethanamine.
| Compound Name | bis(2,2,2-trifluoroethyl) hydrogen phosphate;N-methylmethanamine |
|---|---|
| PubChem CID | 118073252 |
| Molecular Formula | C6H12F6NO4P |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) hydrogen phosphate;N-methylmethanamine |
| SMILES | CNC.O=P(O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C4H5F6O4P.C2H7N/c5-3(6,7)1-13-15(11,12)14-2-4(8,9)10;1-3-2/h1-2H2,(H,11,12);3H,1-2H3 |
| InChIKey | YTHZVCKQKNTJNI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|