C8H13F6O3P — CID 58320064
2-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-methylpropane (PubChem CID 58320064) has the molecular formula C8H13F6O3P and a molecular weight of 302.15 g/mol. Its IUPAC name is 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-methylpropane.
| Compound Name | 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-methylpropane |
|---|---|
| PubChem CID | 58320064 |
| Molecular Formula | C8H13F6O3P |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]-2-methylpropane |
| SMILES | CC(C)(C)P(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C8H13F6O3P/c1-6(2,3)18(15,16-4-7(9,10)11)17-5-8(12,13)14/h4-5H2,1-3H3 |
| InChIKey | XOXZRELPKAPFAF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|