C5H4Cl3F6O3P — CID 13134372
1,1,1-trifluoro-2-[trichloromethyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane (PubChem CID 13134372) has the molecular formula C5H4Cl3F6O3P and a molecular weight of 363.41 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[trichloromethyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane.
| Compound Name | 1,1,1-trifluoro-2-[trichloromethyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane |
|---|---|
| PubChem CID | 13134372 |
| Molecular Formula | C5H4Cl3F6O3P |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 361.89 |
| IUPAC Name | 1,1,1-trifluoro-2-[trichloromethyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane |
| SMILES | O=P(OCC(F)(F)F)(OCC(F)(F)F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H4Cl3F6O3P/c6-5(7,8)18(15,16-1-3(9,10)11)17-2-4(12,13)14/h1-2H2 |
| InChIKey | NXKWDTXSTQSNOJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|