C5H6ClF6O3P — CID 11808614
2-[[chloro(dideuterio)methyl]-(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane (PubChem CID 11808614) has the molecular formula C5H6ClF6O3P and a molecular weight of 296.53 g/mol. Its IUPAC name is 2-[[chloro(dideuterio)methyl]-(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane.
| Compound Name | 2-[[chloro(dideuterio)methyl]-(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 11808614 |
| Molecular Formula | C5H6ClF6O3P |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 2-[[chloro(dideuterio)methyl]-(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane |
| SMILES | [2H]C([2H])(Cl)P(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C5H6ClF6O3P/c6-3-16(13,14-1-4(7,8)9)15-2-5(10,11)12/h1-3H2/i3D2 |
| InChIKey | KMMKPDDIFKSBPI-SMZGMGDZSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|