C2H4F5NO4P2 — CID 130453511
fluoro-N-[fluoro(2,2,2-trifluoroethoxy)phosphoryl]phosphonamidic acid (PubChem CID 130453511) has the molecular formula C2H4F5NO4P2 and a molecular weight of 263.00 g/mol. Its IUPAC name is fluoro-N-[fluoro(2,2,2-trifluoroethoxy)phosphoryl]phosphonamidic acid.
| Compound Name | fluoro-N-[fluoro(2,2,2-trifluoroethoxy)phosphoryl]phosphonamidic acid |
|---|---|
| PubChem CID | 130453511 |
| Molecular Formula | C2H4F5NO4P2 |
| Molecular Weight | 263.00 g/mol |
| Exact Mass | 262.95 |
| IUPAC Name | fluoro-N-[fluoro(2,2,2-trifluoroethoxy)phosphoryl]phosphonamidic acid |
| SMILES | O=P(O)(F)NP(=O)(F)OCC(F)(F)F |
| InChI | InChI=1S/C2H4F5NO4P2/c3-2(4,5)1-12-14(7,11)8-13(6,9)10/h1H2,(H2,8,9,10,11) |
| InChIKey | SVUYIQNKEZGYJR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.00 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|