C11H17F6O4P — CID 175473325
[2-ethyl-4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butyl] prop-2-enyl hydrogen phosphate (PubChem CID 175473325) has the molecular formula C11H17F6O4P and a molecular weight of 358.22 g/mol. Its IUPAC name is [2-ethyl-4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butyl] prop-2-enyl hydrogen phosphate.
| Compound Name | [2-ethyl-4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butyl] prop-2-enyl hydrogen phosphate |
|---|---|
| PubChem CID | 175473325 |
| Molecular Formula | C11H17F6O4P |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | [2-ethyl-4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butyl] prop-2-enyl hydrogen phosphate |
| SMILES | C=CCOP(=O)(O)OCC(CC)(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C11H17F6O4P/c1-3-5-20-22(18,19)21-8-9(4-2,6-10(12,13)14)7-11(15,16)17/h3H,1,4-8H2,2H3,(H,18,19) |
| InChIKey | JHFYJSWMWPWHPI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|