C9H17O5P — CID 87623083
2-ethyl-2-[hydroxy(prop-2-enoxy)phosphoryl]butanoic acid (PubChem CID 87623083) has the molecular formula C9H17O5P and a molecular weight of 236.20 g/mol. Its IUPAC name is 2-ethyl-2-[hydroxy(prop-2-enoxy)phosphoryl]butanoic acid.
| Compound Name | 2-ethyl-2-[hydroxy(prop-2-enoxy)phosphoryl]butanoic acid |
|---|---|
| PubChem CID | 87623083 |
| Molecular Formula | C9H17O5P |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-ethyl-2-[hydroxy(prop-2-enoxy)phosphoryl]butanoic acid |
| SMILES | C=CCOP(=O)(O)C(CC)(CC)C(=O)O |
| InChI | InChI=1S/C9H17O5P/c1-4-7-14-15(12,13)9(5-2,6-3)8(10)11/h4H,1,5-7H2,2-3H3,(H,10,11)(H,12,13) |
| InChIKey | XBWOGZMQEACAFN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|