C9H21O5PSi — CID 87992420
2-ethyl-2-[hydroxy(trimethylsilyloxy)phosphoryl]butanoic acid (PubChem CID 87992420) has the molecular formula C9H21O5PSi and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-ethyl-2-[hydroxy(trimethylsilyloxy)phosphoryl]butanoic acid.
| Compound Name | 2-ethyl-2-[hydroxy(trimethylsilyloxy)phosphoryl]butanoic acid |
|---|---|
| PubChem CID | 87992420 |
| Molecular Formula | C9H21O5PSi |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-ethyl-2-[hydroxy(trimethylsilyloxy)phosphoryl]butanoic acid |
| SMILES | CCC(CC)(C(=O)O)P(=O)(O)O[Si](C)(C)C |
| InChI | InChI=1S/C9H21O5PSi/c1-6-9(7-2,8(10)11)15(12,13)14-16(3,4)5/h6-7H2,1-5H3,(H,10,11)(H,12,13) |
| InChIKey | ZRXQYCKLWYITSH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|