C12H19O5P — CID 88788390
methoxy(4-prop-2-enoxycarbonylhepta-1,6-dien-4-yl)phosphinic acid (PubChem CID 88788390) has the molecular formula C12H19O5P and a molecular weight of 274.25 g/mol. Its IUPAC name is methoxy(4-prop-2-enoxycarbonylhepta-1,6-dien-4-yl)phosphinic acid.
| Compound Name | methoxy(4-prop-2-enoxycarbonylhepta-1,6-dien-4-yl)phosphinic acid |
|---|---|
| PubChem CID | 88788390 |
| Molecular Formula | C12H19O5P |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | methoxy(4-prop-2-enoxycarbonylhepta-1,6-dien-4-yl)phosphinic acid |
| SMILES | C=CCOC(=O)C(CC=C)(CC=C)P(=O)(O)OC |
| InChI | InChI=1S/C12H19O5P/c1-5-8-12(9-6-2,18(14,15)16-4)11(13)17-10-7-3/h5-7H,1-3,8-10H2,4H3,(H,14,15) |
| InChIKey | AWOBCFAPUKCKFC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|