C10H22O8P2 — CID 89278353
[2-[[dihydroxy(methylidene)-λ5-phosphanyl]oxymethyl]-2-(prop-2-enoxymethyl)butyl] dihydrogen phosphate (PubChem CID 89278353) has the molecular formula C10H22O8P2 and a molecular weight of 332.23 g/mol. Its IUPAC name is [2-[[dihydroxy(methylidene)-λ5-phosphanyl]oxymethyl]-2-(prop-2-enoxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [2-[[dihydroxy(methylidene)-λ5-phosphanyl]oxymethyl]-2-(prop-2-enoxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 89278353 |
| Molecular Formula | C10H22O8P2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [2-[[dihydroxy(methylidene)-λ5-phosphanyl]oxymethyl]-2-(prop-2-enoxymethyl)butyl] dihydrogen phosphate |
| SMILES | C=CCOCC(CC)(COP(=C)(O)O)COP(=O)(O)O |
| InChI | InChI=1S/C10H22O8P2/c1-4-6-16-7-10(5-2,8-17-19(3,11)12)9-18-20(13,14)15/h4,11-12H,1,3,5-9H2,2H3,(H2,13,14,15) |
| InChIKey | XHAIYUKEKBFETL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|