C16H26O7 — CID 90473270
4-[2,2-bis(prop-2-enoxymethyl)butoxy]-2-hydroxy-4-oxobutanoic acid (PubChem CID 90473270) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-[2,2-bis(prop-2-enoxymethyl)butoxy]-2-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-[2,2-bis(prop-2-enoxymethyl)butoxy]-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90473270 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 4-[2,2-bis(prop-2-enoxymethyl)butoxy]-2-hydroxy-4-oxobutanoic acid |
| SMILES | C=CCOCC(CC)(COCC=C)COC(=O)CC(O)C(=O)O |
| InChI | InChI=1S/C16H26O7/c1-4-7-21-10-16(6-3,11-22-8-5-2)12-23-14(18)9-13(17)15(19)20/h4-5,13,17H,1-2,6-12H2,3H3,(H,19,20) |
| InChIKey | JJDCAMLIEUSXPB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|