C16H32O7 — CID 173084371
ethene;2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid;2-propan-2-yloxypropane (PubChem CID 173084371) has the molecular formula C16H32O7 and a molecular weight of 336.43 g/mol. Its IUPAC name is ethene;2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid;2-propan-2-yloxypropane.
| Compound Name | ethene;2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid;2-propan-2-yloxypropane |
|---|---|
| PubChem CID | 173084371 |
| Molecular Formula | C16H32O7 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | ethene;2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid;2-propan-2-yloxypropane |
| SMILES | C=C.C=C.CC(C)OC(C)C.O=C(CC(O)C(=O)O)OCCO |
| InChI | InChI=1S/C6H10O6.C6H14O.2C2H4/c7-1-2-12-5(9)3-4(8)6(10)11;1-5(2)7-6(3)4;2*1-2/h4,7-8H,1-3H2,(H,10,11);5-6H,1-4H3;2*1-2H2 |
| InChIKey | MAHUVUOXQBMHJY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|