C10H16O7 — CID 162441222
4-(4-ethoxy-4-oxobutan-2-yl)oxy-2-hydroxy-4-oxobutanoic acid (PubChem CID 162441222) has the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. Its IUPAC name is 4-(4-ethoxy-4-oxobutan-2-yl)oxy-2-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-(4-ethoxy-4-oxobutan-2-yl)oxy-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 162441222 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-(4-ethoxy-4-oxobutan-2-yl)oxy-2-hydroxy-4-oxobutanoic acid |
| SMILES | CCOC(=O)CC(C)OC(=O)CC(O)C(=O)O |
| InChI | InChI=1S/C10H16O7/c1-3-16-8(12)4-6(2)17-9(13)5-7(11)10(14)15/h6-7,11H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | HUSYCZHJVVMEJI-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |